C28H24N4O3 — CID 75193835
5-[(5-benzyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 75193835) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 5-[(5-benzyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-benzyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75193835 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 5-[(5-benzyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2C(=O)NC(=Cc3c(Cc4ccccc4)[nH]n(-c4ccccc4)c3=O)C2=O)c1 |
| InChI | InChI=1S/C28H24N4O3/c1-19-9-8-12-21(15-19)18-31-27(34)25(29-28(31)35)17-23-24(16-20-10-4-2-5-11-20)30-32(26(23)33)22-13-6-3-7-14-22/h2-15,17,30H,16,18H2,1H3,(H,29,35) |
| InChIKey | YJSJZWPYBUYKNV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|