C25H18F2N4O3S — CID 75193934
3-[(2,4-difluorophenyl)methyl]-5-[[3-oxo-2-phenyl-5-(thiophen-2-ylmethyl)-1H-pyrazol-4-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 75193934) has the molecular formula C25H18F2N4O3S and a molecular weight of 492.51 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-5-[[3-oxo-2-phenyl-5-(thiophen-2-ylmethyl)-1H-pyrazol-4-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-5-[[3-oxo-2-phenyl-5-(thiophen-2-ylmethyl)-1H-pyrazol-4-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75193934 |
| Molecular Formula | C25H18F2N4O3S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-5-[[3-oxo-2-phenyl-5-(thiophen-2-ylmethyl)-1H-pyrazol-4-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=Cc2c(Cc3cccs3)[nH]n(-c3ccccc3)c2=O)C(=O)N1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C25H18F2N4O3S/c26-16-9-8-15(20(27)11-16)14-30-24(33)22(28-25(30)34)13-19-21(12-18-7-4-10-35-18)29-31(23(19)32)17-5-2-1-3-6-17/h1-11,13,29H,12,14H2,(H,28,34) |
| InChIKey | PEDFLUUBIBUKLB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|