C24H21N5O7 — CID 75193943
methyl 3-[[4-[[5-ethyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]benzoate (PubChem CID 75193943) has the molecular formula C24H21N5O7 and a molecular weight of 491.46 g/mol. Its IUPAC name is methyl 3-[[4-[[5-ethyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-[[5-ethyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 75193943 |
| Molecular Formula | C24H21N5O7 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | methyl 3-[[4-[[5-ethyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]benzoate |
| SMILES | CCc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1C=C1NC(=O)N(Cc2cccc(C(=O)OC)c2)C1=O |
| InChI | InChI=1S/C24H21N5O7/c1-3-19-18(21(30)28(26-19)16-7-9-17(10-8-16)29(34)35)12-20-22(31)27(24(33)25-20)13-14-5-4-6-15(11-14)23(32)36-2/h4-12,26H,3,13H2,1-2H3,(H,25,33) |
| InChIKey | NVPFUYQOGXWDER-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|