C28H23FN4O3 — CID 75193891
5-[[2-(2,3-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 75193891) has the molecular formula C28H23FN4O3 and a molecular weight of 482.52 g/mol. Its IUPAC name is 5-[[2-(2,3-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[2-(2,3-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75193891 |
| Molecular Formula | C28H23FN4O3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 5-[[2-(2,3-dimethylphenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(-n2[nH]c(-c3ccccc3)c(C=C3NC(=O)N(Cc4cccc(F)c4)C3=O)c2=O)c1C |
| InChI | InChI=1S/C28H23FN4O3/c1-17-8-6-13-24(18(17)2)33-26(34)22(25(31-33)20-10-4-3-5-11-20)15-23-27(35)32(28(36)30-23)16-19-9-7-12-21(29)14-19/h3-15,31H,16H2,1-2H3,(H,30,36) |
| InChIKey | VVCWSEOCTSQENF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|