C20H21N5O2S — CID 75201415
7-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]-1,3,4,5-tetrahydropyrido[2,3-e][1,4]diazepin-2-one (PubChem CID 75201415) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 7-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]-1,3,4,5-tetrahydropyrido[2,3-e][1,4]diazepin-2-one.
| Compound Name | 7-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]-1,3,4,5-tetrahydropyrido[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 75201415 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 7-[(E)-3-oxo-3-[4-(1,3-thiazol-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]-1,3,4,5-tetrahydropyrido[2,3-e][1,4]diazepin-2-one |
| SMILES | O=C1CNCc2cc(/C=C/C(=O)N3CCC(=Cc4nccs4)CC3)cnc2N1 |
| InChI | InChI=1S/C20H21N5O2S/c26-17-13-21-12-16-9-15(11-23-20(16)24-17)1-2-19(27)25-6-3-14(4-7-25)10-18-22-5-8-28-18/h1-2,5,8-11,21H,3-4,6-7,12-13H2,(H,23,24,26)/b2-1+ |
| InChIKey | RFHISOGPRPUQLK-OWOJBTEDSA-N |
| XLogP | 2.30 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|