C27H29F3N4O4S — CID 75201462
6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one;2,2,2-trifluoroacetic acid (PubChem CID 75201462) has the molecular formula C27H29F3N4O4S and a molecular weight of 562.61 g/mol. Its IUPAC name is 6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 75201462 |
| Molecular Formula | C27H29F3N4O4S |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 6-[(E)-3-oxo-3-[4-(thiophen-2-ylmethylidene)piperidin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(/C=C/c1cnc2c(c1)CC1(CCNCC1)C(=O)N2)N1CCC(=Cc2cccs2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4O2S.C2HF3O2/c30-22(29-11-5-18(6-12-29)15-21-2-1-13-32-21)4-3-19-14-20-16-25(7-9-26-10-8-25)24(31)28-23(20)27-17-19;3-2(4,5)1(6)7/h1-4,13-15,17,26H,5-12,16H2,(H,27,28,31);(H,6,7)/b4-3+; |
| InChIKey | FOZNTPWDVREPTC-BJILWQEISA-N |
| XLogP | 4.36 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|