(6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid

C18H28O3 — CID 75203220

IUPAC(6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid
SMILESCC/C=C\CC/C=C/C(=O)CC/C=C\CCCCC(=O)O
InChIInChI=1S/C18H28O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h3-4,6,9,11,14H,2,5,7-8,10,12-13,15-16H2,1H3,(H,20,21)/b4-3-,9-6-,14-11+
InChIKeyJBZPUWRMHKLHII-MXQZESCKSA-N
MW292.42 g/mol
LogP4.84
Rot. Bonds13

About (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid

(6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid (PubChem CID 75203220) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid.

Molecular Properties

Compound Name(6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid
PubChem CID75203220
Molecular FormulaC18H28O3
Molecular Weight292.42 g/mol
Exact Mass292.20
IUPAC Name(6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid
SMILESCC/C=C\CC/C=C/C(=O)CC/C=C\CCCCC(=O)O
InChIInChI=1S/C18H28O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h3-4,6,9,11,14H,2,5,7-8,10,12-13,15-16H2,1H3,(H,20,21)/b4-3-,9-6-,14-11+
InChIKeyJBZPUWRMHKLHII-MXQZESCKSA-N
XLogP4.84
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds13
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.42
LogP ≤ 54.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid?
The IUPAC name of (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid (CID 75203220) is (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid.
What is the SMILES notation for (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid?
The canonical SMILES for (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid is CC/C=C\CC/C=C/C(=O)CC/C=C\CCCCC(=O)O.
What is the InChIKey of (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid?
The InChIKey is JBZPUWRMHKLHII-MXQZESCKSA-N. The full InChI is InChI=1S/C18H28O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h3-4,6,9,11,14H,2,5,7-8,10,12-13,15-16H2,1H3,(H,20,21)/b4-3-,9-6-,14-11+.
What are the key properties of (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid?
(6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid has a molecular weight of 292.42 g/mol, XLogP of 4.84, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,11E,15Z)-10-oxooctadeca-6,11,15-trienoic acid is sourced from PubChem (CID 75203220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).