C22H31N5O4 — CID 7520668
methyl 2-[4,7,8-trimethyl-1,3-dioxo-6-[(1R,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazol-2-yl]acetate (PubChem CID 7520668) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 2-[4,7,8-trimethyl-1,3-dioxo-6-[(1R,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazol-2-yl]acetate.
| Compound Name | methyl 2-[4,7,8-trimethyl-1,3-dioxo-6-[(1R,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazol-2-yl]acetate |
|---|---|
| PubChem CID | 7520668 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | methyl 2-[4,7,8-trimethyl-1,3-dioxo-6-[(1R,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazol-2-yl]acetate |
| SMILES | COC(=O)Cn1c(=O)c2c(nc3n([C@@H]4C[C@H](C)CC(C)(C)C4)c(C)c(C)n23)n(C)c1=O |
| InChI | InChI=1S/C22H31N5O4/c1-12-8-15(10-22(4,5)9-12)26-13(2)14(3)27-17-18(23-20(26)27)24(6)21(30)25(19(17)29)11-16(28)31-7/h12,15H,8-11H2,1-7H3/t12-,15+/m0/s1 |
| InChIKey | SPGDRGQOETWDPH-SWLSCSKDSA-N |
| XLogP | 2.33 |
| TPSA | 92.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |