C22H31N5O3 — CID 7520674
4,7,8-trimethyl-2-(2-oxopropyl)-6-[(1R,5S)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione (PubChem CID 7520674) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4,7,8-trimethyl-2-(2-oxopropyl)-6-[(1R,5S)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 4,7,8-trimethyl-2-(2-oxopropyl)-6-[(1R,5S)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 7520674 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4,7,8-trimethyl-2-(2-oxopropyl)-6-[(1R,5S)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione |
| SMILES | CC(=O)Cn1c(=O)c2c(nc3n([C@@H]4C[C@@H](C)CC(C)(C)C4)c(C)c(C)n23)n(C)c1=O |
| InChI | InChI=1S/C22H31N5O3/c1-12-8-16(10-22(5,6)9-12)26-14(3)15(4)27-17-18(23-20(26)27)24(7)21(30)25(19(17)29)11-13(2)28/h12,16H,8-11H2,1-7H3/t12-,16-/m1/s1 |
| InChIKey | VKTGDDYPRIYTPJ-MLGOLLRUSA-N |
| XLogP | 2.74 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |