C21H29N5O2 — CID 7520614
4,7-dimethyl-2-prop-2-enyl-6-[(1S,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione (PubChem CID 7520614) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 4,7-dimethyl-2-prop-2-enyl-6-[(1S,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 4,7-dimethyl-2-prop-2-enyl-6-[(1S,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 7520614 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 4,7-dimethyl-2-prop-2-enyl-6-[(1S,5R)-3,3,5-trimethylcyclohexyl]purino[7,8-a]imidazole-1,3-dione |
| SMILES | C=CCn1c(=O)c2c(nc3n([C@H]4C[C@H](C)CC(C)(C)C4)c(C)cn23)n(C)c1=O |
| InChI | InChI=1S/C21H29N5O2/c1-7-8-24-18(27)16-17(23(6)20(24)28)22-19-25(16)12-14(3)26(19)15-9-13(2)10-21(4,5)11-15/h7,12-13,15H,1,8-11H2,2-6H3/t13-,15-/m0/s1 |
| InChIKey | VCOIAISFTUQWTK-ZFWWWQNUSA-N |
| XLogP | 3.03 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|