C22H24ClNO3 — CID 7521106
[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 7521106) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7521106 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | CCC[C@@H](NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H24ClNO3/c1-2-6-19(16-7-4-3-5-8-16)24-20(25)15-27-21(26)22(13-14-22)17-9-11-18(23)12-10-17/h3-5,7-12,19H,2,6,13-15H2,1H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | FTWPDTUTNIAIGF-LJQANCHMSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |