C19H19ClFN3O2 — CID 75212111
1-N-butyl-4-chloro-2-N-[(2-fluorophenyl)methylideneamino]benzene-1,2-dicarboxamide (PubChem CID 75212111) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is 1-N-butyl-4-chloro-2-N-[(2-fluorophenyl)methylideneamino]benzene-1,2-dicarboxamide.
| Compound Name | 1-N-butyl-4-chloro-2-N-[(2-fluorophenyl)methylideneamino]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 75212111 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1-N-butyl-4-chloro-2-N-[(2-fluorophenyl)methylideneamino]benzene-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)c1ccc(Cl)cc1C(=O)NN=Cc1ccccc1F |
| InChI | InChI=1S/C19H19ClFN3O2/c1-2-3-10-22-18(25)15-9-8-14(20)11-16(15)19(26)24-23-12-13-6-4-5-7-17(13)21/h4-9,11-12H,2-3,10H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | OXOWFAJYHWGELM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|