C21H30O6 — CID 75224310
1-(hydroxymethyl)-5-[[5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl]-4,8-dioxatricyclo[5.1.0.03,5]octane-2,6-dione (PubChem CID 75224310) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-(hydroxymethyl)-5-[[5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl]-4,8-dioxatricyclo[5.1.0.03,5]octane-2,6-dione.
| Compound Name | 1-(hydroxymethyl)-5-[[5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl]-4,8-dioxatricyclo[5.1.0.03,5]octane-2,6-dione |
|---|---|
| PubChem CID | 75224310 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-(hydroxymethyl)-5-[[5-(hydroxymethyl)-5,8a-dimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl]-4,8-dioxatricyclo[5.1.0.03,5]octane-2,6-dione |
| SMILES | CC1(CO)CCCC2(C)C(CC34OC3C(=O)C3(CO)OC3C4=O)CCCC12 |
| InChI | InChI=1S/C21H30O6/c1-18(10-22)7-4-8-19(2)12(5-3-6-13(18)19)9-20-14(24)17-21(11-23,27-17)15(25)16(20)26-20/h12-13,16-17,22-23H,3-11H2,1-2H3 |
| InChIKey | HJQRCWZAKDUEPB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|