C22H27N3O2S — CID 75271656
6-benzyl-2-[(3-methoxyphenyl)methylsulfanyl]-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 75271656) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 6-benzyl-2-[(3-methoxyphenyl)methylsulfanyl]-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-benzyl-2-[(3-methoxyphenyl)methylsulfanyl]-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75271656 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 6-benzyl-2-[(3-methoxyphenyl)methylsulfanyl]-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1cccc(CSC2NC(=O)C3CN(Cc4ccccc4)CCC3N2)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-27-18-9-5-8-17(12-18)15-28-22-23-20-10-11-25(14-19(20)21(26)24-22)13-16-6-3-2-4-7-16/h2-9,12,19-20,22-23H,10-11,13-15H2,1H3,(H,24,26) |
| InChIKey | LSWXLMCUIVTOAR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |