C20H27N3O3 — CID 75279408
N-[2-[(3,4-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)amino]-2-oxoethyl]benzamide (PubChem CID 75279408) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[2-[(3,4-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(3,4-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 75279408 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[2-[(3,4-dimethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CC1C(=O)NC2CC(NC(=O)CNC(=O)c3ccccc3)CCC2C1C |
| InChI | InChI=1S/C20H27N3O3/c1-12-13(2)19(25)23-17-10-15(8-9-16(12)17)22-18(24)11-21-20(26)14-6-4-3-5-7-14/h3-7,12-13,15-17H,8-11H2,1-2H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | JQDBBGOBSXNLJA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |