C19H24N4O2S — CID 75279382
N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 75279382) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 75279382 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | CCC1C(=O)NC2CC(NC(=O)c3ccc4nsnc4c3)CCC2C1C |
| InChI | InChI=1S/C19H24N4O2S/c1-3-13-10(2)14-6-5-12(9-16(14)21-19(13)25)20-18(24)11-4-7-15-17(8-11)23-26-22-15/h4,7-8,10,12-14,16H,3,5-6,9H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | MPAQDFNBELOHJP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |