C21H27N5O2 — CID 75279146
N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-phenyltriazole-4-carboxamide (PubChem CID 75279146) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 75279146 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-2-phenyltriazole-4-carboxamide |
| SMILES | CCC1C(=O)NC2CC(NC(=O)c3cnn(-c4ccccc4)n3)CCC2C1C |
| InChI | InChI=1S/C21H27N5O2/c1-3-16-13(2)17-10-9-14(11-18(17)24-20(16)27)23-21(28)19-12-22-26(25-19)15-7-5-4-6-8-15/h4-8,12-14,16-18H,3,9-11H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | ISXTXIHIECPEAY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |