C16H25N5O2 — CID 75279386
N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyltriazole-4-carboxamide (PubChem CID 75279386) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyltriazole-4-carboxamide.
| Compound Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 75279386 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyltriazole-4-carboxamide |
| SMILES | CCC1C(=O)NC2CC(NC(=O)c3cn(C)nn3)CCC2C1C |
| InChI | InChI=1S/C16H25N5O2/c1-4-11-9(2)12-6-5-10(7-13(12)18-15(11)22)17-16(23)14-8-21(3)20-19-14/h8-13H,4-7H2,1-3H3,(H,17,23)(H,18,22) |
| InChIKey | RDQFJSRKPCBWGO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |