C31H44O2S — CID 75291282
5-[2-[7a-methyl-1-[1-(3-propan-2-ylphenyl)sulfanylpropan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 75291282) has the molecular formula C31H44O2S and a molecular weight of 480.76 g/mol. Its IUPAC name is 5-[2-[7a-methyl-1-[1-(3-propan-2-ylphenyl)sulfanylpropan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | 5-[2-[7a-methyl-1-[1-(3-propan-2-ylphenyl)sulfanylpropan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 75291282 |
| Molecular Formula | C31H44O2S |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 5-[2-[7a-methyl-1-[1-(3-propan-2-ylphenyl)sulfanylpropan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(O)CC(=CC=C2CCCC3(C)C2CCC3C(C)CSc2cccc(C(C)C)c2)CC1O |
| InChI | InChI=1S/C31H44O2S/c1-20(2)25-8-6-10-26(18-25)34-19-21(3)27-13-14-28-24(9-7-15-31(27,28)5)12-11-23-16-29(32)22(4)30(33)17-23/h6,8,10-12,18,20-21,27-30,32-33H,4,7,9,13-17,19H2,1-3,5H3 |
| InChIKey | CCXQZEJTPZPFSG-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|