C18H15ClO3S — CID 75301545
6-[8-(3-chlorothiophen-2-yl)octa-1,3,5,7-tetraenyl]-4-methoxypyran-2-one (PubChem CID 75301545) has the molecular formula C18H15ClO3S and a molecular weight of 346.84 g/mol. Its IUPAC name is 6-[8-(3-chlorothiophen-2-yl)octa-1,3,5,7-tetraenyl]-4-methoxypyran-2-one.
| Compound Name | 6-[8-(3-chlorothiophen-2-yl)octa-1,3,5,7-tetraenyl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 75301545 |
| Molecular Formula | C18H15ClO3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 6-[8-(3-chlorothiophen-2-yl)octa-1,3,5,7-tetraenyl]-4-methoxypyran-2-one |
| SMILES | COc1cc(C=CC=CC=CC=Cc2sccc2Cl)oc(=O)c1 |
| InChI | InChI=1S/C18H15ClO3S/c1-21-15-12-14(22-18(20)13-15)8-6-4-2-3-5-7-9-17-16(19)10-11-23-17/h2-13H,1H3 |
| InChIKey | NIDZMYFXGLEUNO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|