C20H16N6O3 — CID 7532387
4-methyl-N-[4-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]-3-nitrobenzamide (PubChem CID 7532387) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 4-methyl-N-[4-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-methyl-N-[4-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 7532387 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-methyl-N-[4-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(-c3ccc4nnc(C)n4n3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N6O3/c1-12-3-4-15(11-18(12)26(28)29)20(27)21-16-7-5-14(6-8-16)17-9-10-19-23-22-13(2)25(19)24-17/h3-11H,1-2H3,(H,21,27) |
| InChIKey | DGHDPGRYIZKTDA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|