C21H18N4O4 — CID 75358513
5-[(2-methoxyphenoxy)methyl]-N-(5-pyridin-4-yl-1H-pyrazol-3-yl)furan-2-carboxamide (PubChem CID 75358513) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-N-(5-pyridin-4-yl-1H-pyrazol-3-yl)furan-2-carboxamide.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-N-(5-pyridin-4-yl-1H-pyrazol-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 75358513 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-N-(5-pyridin-4-yl-1H-pyrazol-3-yl)furan-2-carboxamide |
| SMILES | COc1ccccc1OCc1ccc(C(=O)Nc2cc(-c3ccncc3)[nH]n2)o1 |
| InChI | InChI=1S/C21H18N4O4/c1-27-17-4-2-3-5-18(17)28-13-15-6-7-19(29-15)21(26)23-20-12-16(24-25-20)14-8-10-22-11-9-14/h2-12H,13H2,1H3,(H2,23,24,25,26) |
| InChIKey | QCNFKBNUMWQQAU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |