C19H19N3O — CID 75360175
4-(3,4-dimethylphenyl)-6-(4-methoxyphenyl)pyrimidin-2-amine (PubChem CID 75360175) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-6-(4-methoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-(3,4-dimethylphenyl)-6-(4-methoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 75360175 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-6-(4-methoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)c(C)c3)nc(N)n2)cc1 |
| InChI | InChI=1S/C19H19N3O/c1-12-4-5-15(10-13(12)2)18-11-17(21-19(20)22-18)14-6-8-16(23-3)9-7-14/h4-11H,1-3H3,(H2,20,21,22) |
| InChIKey | BOBAVEFGEONVTJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |