C20H21N3O3S — CID 75361450
4-[(E)-3-[(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 75361450) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[(E)-3-[(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 75361450 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-[(E)-3-[(5,5-dimethyl-7-oxo-4,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)Nc2nc3c(s2)C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-20(2)10-14-17(15(24)11-20)27-19(22-14)23-16(25)9-6-12-4-7-13(8-5-12)18(26)21-3/h4-9H,10-11H2,1-3H3,(H,21,26)(H,22,23,25)/b9-6+ |
| InChIKey | KLKWYJUMPWMFTQ-RMKNXTFCSA-N |
| XLogP | 3.31 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|