C18H16FN3O2S — CID 75365072
N'-[(Z)-(8-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-N-(4-methylphenyl)oxamide (PubChem CID 75365072) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is N'-[(Z)-(8-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-(8-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 75365072 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N'-[(Z)-(8-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C2/CCSc3c(F)cccc32)cc1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-11-5-7-12(8-6-11)20-17(23)18(24)22-21-15-9-10-25-16-13(15)3-2-4-14(16)19/h2-8H,9-10H2,1H3,(H,20,23)(H,22,24)/b21-15- |
| InChIKey | YDNFSBOJFJOYAI-QNGOZBTKSA-N |
| XLogP | 3.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|