C17H19N5OS — CID 75371670
1-ethyl-N-[2-methyl-4-(1-methylimidazol-2-yl)sulfanylphenyl]pyrazole-4-carboxamide (PubChem CID 75371670) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-ethyl-N-[2-methyl-4-(1-methylimidazol-2-yl)sulfanylphenyl]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-[2-methyl-4-(1-methylimidazol-2-yl)sulfanylphenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75371670 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-ethyl-N-[2-methyl-4-(1-methylimidazol-2-yl)sulfanylphenyl]pyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2ccc(Sc3nccn3C)cc2C)cn1 |
| InChI | InChI=1S/C17H19N5OS/c1-4-22-11-13(10-19-22)16(23)20-15-6-5-14(9-12(15)2)24-17-18-7-8-21(17)3/h5-11H,4H2,1-3H3,(H,20,23) |
| InChIKey | XUYHGQDYZHHUNW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |