C17H26N2O4 — CID 75372461
2-[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]piperidin-4-yl]-N-methyl-N-propan-2-ylacetamide (PubChem CID 75372461) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]piperidin-4-yl]-N-methyl-N-propan-2-ylacetamide.
| Compound Name | 2-[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]piperidin-4-yl]-N-methyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 75372461 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-[1-[(5-hydroxy-4-oxopyran-2-yl)methyl]piperidin-4-yl]-N-methyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C)C(=O)CC1CCN(Cc2cc(=O)c(O)co2)CC1 |
| InChI | InChI=1S/C17H26N2O4/c1-12(2)18(3)17(22)8-13-4-6-19(7-5-13)10-14-9-15(20)16(21)11-23-14/h9,11-13,21H,4-8,10H2,1-3H3 |
| InChIKey | XOCODKRYDLHGHW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |