C18H22N2O2S — CID 75373415
N-[5-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl)-4-methylthiophen-2-yl]cyclopropanecarboxamide (PubChem CID 75373415) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-[5-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl)-4-methylthiophen-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl)-4-methylthiophen-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 75373415 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[5-(1,3,3a,4,7,7a-hexahydroisoindole-2-carbonyl)-4-methylthiophen-2-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2)sc1C(=O)N1CC2CC=CCC2C1 |
| InChI | InChI=1S/C18H22N2O2S/c1-11-8-15(19-17(21)12-6-7-12)23-16(11)18(22)20-9-13-4-2-3-5-14(13)10-20/h2-3,8,12-14H,4-7,9-10H2,1H3,(H,19,21) |
| InChIKey | ZNQULIGOLSMSQM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|