C20H22N4O6S2 — CID 43041317
N-[4-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]thiophen-2-yl]cyclopropanecarboxamide (PubChem CID 43041317) has the molecular formula C20H22N4O6S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[4-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]thiophen-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]thiophen-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43041317 |
| Molecular Formula | C20H22N4O6S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[4-methyl-5-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]thiophen-2-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2)sc1C(=O)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H22N4O6S2/c1-13-11-17(21-19(25)14-5-6-14)31-18(13)20(26)22-7-9-23(10-8-22)32(29,30)16-4-2-3-15(12-16)24(27)28/h2-4,11-12,14H,5-10H2,1H3,(H,21,25) |
| InChIKey | PCXFUEPCILTBBP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|