C17H21F3N2O2 — CID 75373937
2-(2-acetylanilino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 75373937) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(2-acetylanilino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(2-acetylanilino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 75373937 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(2-acetylanilino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | CC(=O)c1ccccc1NCC(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-11(23)14-4-2-3-5-15(14)21-10-16(24)22-13-8-6-12(7-9-13)17(18,19)20/h2-5,12-13,21H,6-10H2,1H3,(H,22,24) |
| InChIKey | KTPQBWJMNAXPSS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |