C12H24IN5O3 — CID 75375104
1,2-bis(2-methoxyethyl)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 75375104) has the molecular formula C12H24IN5O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is 1,2-bis(2-methoxyethyl)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,2-bis(2-methoxyethyl)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75375104 |
| Molecular Formula | C12H24IN5O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1,2-bis(2-methoxyethyl)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | COCC/N=C(\NCCOC)NCCc1nc(C)no1.I |
| InChI | InChI=1S/C12H23N5O3.HI/c1-10-16-11(20-17-10)4-5-13-12(14-6-8-18-2)15-7-9-19-3;/h4-9H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | ZXGCFBMVWPNZID-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|