C15H22IN5O2 — CID 75375827
1-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-(furan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 75375827) has the molecular formula C15H22IN5O2 and a molecular weight of 431.28 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-(furan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-(furan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 75375827 |
| Molecular Formula | C15H22IN5O2 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-(furan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccco1)NCCc1noc(CC)n1.I |
| InChI | InChI=1S/C15H21N5O2.HI/c1-3-8-16-15(18-11-12-6-5-10-21-12)17-9-7-13-19-14(4-2)22-20-13;/h3,5-6,10H,1,4,7-9,11H2,2H3,(H2,16,17,18);1H |
| InChIKey | XFBBDSKIJYVVHR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|