C13H13F4NOS — CID 75376476
2,3,5,6-tetrafluoro-N-(thian-4-ylmethyl)benzamide (PubChem CID 75376476) has the molecular formula C13H13F4NOS and a molecular weight of 307.31 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(thian-4-ylmethyl)benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-(thian-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 75376476 |
| Molecular Formula | C13H13F4NOS |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(thian-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCSCC1)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H13F4NOS/c14-8-5-9(15)12(17)10(11(8)16)13(19)18-6-7-1-3-20-4-2-7/h5,7H,1-4,6H2,(H,18,19) |
| InChIKey | QALHTAQJLDZRIX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|