C13H13F4NO2 — CID 97062740
N-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 97062740) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is N-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | N-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 97062740 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[(1S)-1-cyclopropyl-2-methoxyethyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | COC[C@@H](NC(=O)c1c(F)c(F)cc(F)c1F)C1CC1 |
| InChI | InChI=1S/C13H13F4NO2/c1-20-5-9(6-2-3-6)18-13(19)10-11(16)7(14)4-8(15)12(10)17/h4,6,9H,2-3,5H2,1H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | YIDBRSMZXVIQIC-SECBINFHSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|