C18H18N4O2 — CID 75376691
2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-4-carboxamide (PubChem CID 75376691) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-4-carboxamide.
| Compound Name | 2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 75376691 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(N2CCCC(c3nc4ccccc4o3)C2)c1 |
| InChI | InChI=1S/C18H18N4O2/c19-17(23)12-7-8-20-16(10-12)22-9-3-4-13(11-22)18-21-14-5-1-2-6-15(14)24-18/h1-2,5-8,10,13H,3-4,9,11H2,(H2,19,23) |
| InChIKey | VQRJAAQXYXVDCN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |