C16H15ClN4O — CID 71978149
2-[1-(6-chloropyrazin-2-yl)piperidin-3-yl]-1,3-benzoxazole (PubChem CID 71978149) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 2-[1-(6-chloropyrazin-2-yl)piperidin-3-yl]-1,3-benzoxazole.
| Compound Name | 2-[1-(6-chloropyrazin-2-yl)piperidin-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 71978149 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[1-(6-chloropyrazin-2-yl)piperidin-3-yl]-1,3-benzoxazole |
| SMILES | Clc1cncc(N2CCCC(c3nc4ccccc4o3)C2)n1 |
| InChI | InChI=1S/C16H15ClN4O/c17-14-8-18-9-15(20-14)21-7-3-4-11(10-21)16-19-12-5-1-2-6-13(12)22-16/h1-2,5-6,8-9,11H,3-4,7,10H2 |
| InChIKey | ONGFDLQRCHMZGV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |