C22H22N4O3 — CID 11689657
2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-3-yl]-1,3-benzoxazole (PubChem CID 11689657) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-3-yl]-1,3-benzoxazole.
| Compound Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 11689657 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-3-yl]-1,3-benzoxazole |
| SMILES | COc1cc2ncnc(N3CCCC(c4nc5ccccc5o4)C3)c2cc1OC |
| InChI | InChI=1S/C22H22N4O3/c1-27-19-10-15-17(11-20(19)28-2)23-13-24-21(15)26-9-5-6-14(12-26)22-25-16-7-3-4-8-18(16)29-22/h3-4,7-8,10-11,13-14H,5-6,9,12H2,1-2H3 |
| InChIKey | GWXITLQUVKLYPI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |