C15H23NO2S — CID 75380074
N,N-dimethyl-4-[1-(3-methylphenyl)ethylsulfinyl]butanamide (PubChem CID 75380074) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(3-methylphenyl)ethylsulfinyl]butanamide.
| Compound Name | N,N-dimethyl-4-[1-(3-methylphenyl)ethylsulfinyl]butanamide |
|---|---|
| PubChem CID | 75380074 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N,N-dimethyl-4-[1-(3-methylphenyl)ethylsulfinyl]butanamide |
| SMILES | Cc1cccc(C(C)S(=O)CCCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H23NO2S/c1-12-7-5-8-14(11-12)13(2)19(18)10-6-9-15(17)16(3)4/h5,7-8,11,13H,6,9-10H2,1-4H3 |
| InChIKey | AXMQDKYJDBXLDW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |