C18H28N2O3 — CID 69247006
tert-butyl-[4-(dimethylamino)-1-(3-methylphenyl)-4-oxobutyl]carbamic acid (PubChem CID 69247006) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl-[4-(dimethylamino)-1-(3-methylphenyl)-4-oxobutyl]carbamic acid.
| Compound Name | tert-butyl-[4-(dimethylamino)-1-(3-methylphenyl)-4-oxobutyl]carbamic acid |
|---|---|
| PubChem CID | 69247006 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl-[4-(dimethylamino)-1-(3-methylphenyl)-4-oxobutyl]carbamic acid |
| SMILES | Cc1cccc(C(CCC(=O)N(C)C)N(C(=O)O)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28N2O3/c1-13-8-7-9-14(12-13)15(10-11-16(21)19(5)6)20(17(22)23)18(2,3)4/h7-9,12,15H,10-11H2,1-6H3,(H,22,23) |
| InChIKey | OZEDIYDLMVDUQJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |