C16H14N4O3S — CID 75385748
4-cyano-N-[4-methyl-5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]benzenesulfonamide (PubChem CID 75385748) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-cyano-N-[4-methyl-5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[4-methyl-5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 75385748 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-cyano-N-[4-methyl-5-(5-methylfuran-2-yl)-1H-pyrazol-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2[nH]nc(NS(=O)(=O)c3ccc(C#N)cc3)c2C)o1 |
| InChI | InChI=1S/C16H14N4O3S/c1-10-3-8-14(23-10)15-11(2)16(19-18-15)20-24(21,22)13-6-4-12(9-17)5-7-13/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | AJVAJDGLWWDSCU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |