C14H16F3N3O3 — CID 75386188
3-[(3-nitrophenyl)methylamino]-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 75386188) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 3-[(3-nitrophenyl)methylamino]-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | 3-[(3-nitrophenyl)methylamino]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 75386188 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-[(3-nitrophenyl)methylamino]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | O=C1C(NCc2cccc([N+](=O)[O-])c2)CCCN1CC(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O3/c15-14(16,17)9-19-6-2-5-12(13(19)21)18-8-10-3-1-4-11(7-10)20(22)23/h1,3-4,7,12,18H,2,5-6,8-9H2 |
| InChIKey | CJUYKFZMBHVROJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|