About N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine
N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine (PubChem CID 75386771) has the molecular formula C15H24N4S
and a molecular weight of 292.45 g/mol. Its IUPAC name is N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine.
Molecular Properties
| Compound Name | N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine |
| PubChem CID | 75386771 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine |
| SMILES | CSCCC(C)N(C)Cc1cn2c(C)cc(C)nc2n1 |
| InChI | InChI=1S/C15H24N4S/c1-11-8-13(3)19-10-14(17-15(19)16-11)9-18(4)12(2)6-7-20-5/h8,10,12H,6-7,9H2,1-5H3 |
| InChIKey | UXISVVSMIPJWBI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
The IUPAC name of N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine (CID 75386771) is N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine.
What is the SMILES notation for N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
The canonical SMILES for N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine is CSCCC(C)N(C)Cc1cn2c(C)cc(C)nc2n1.
What is the InChIKey of N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
The InChIKey is UXISVVSMIPJWBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4S/c1-11-8-13(3)19-10-14(17-15(19)16-11)9-18(4)12(2)6-7-20-5/h8,10,12H,6-7,9H2,1-5H3.
What are the key properties of N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine has a molecular weight of 292.45 g/mol, XLogP of 2.92, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-4-methylsulfanylbutan-2-amine is sourced from PubChem (CID 75386771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).