C12H12N2O2S2 — CID 75387926
N-(4-oxo-4-thiophen-2-ylbutan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 75387926) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(4-oxo-4-thiophen-2-ylbutan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-oxo-4-thiophen-2-ylbutan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 75387926 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N-(4-oxo-4-thiophen-2-ylbutan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(CC(=O)c1cccs1)NC(=O)c1cscn1 |
| InChI | InChI=1S/C12H12N2O2S2/c1-8(5-10(15)11-3-2-4-18-11)14-12(16)9-6-17-7-13-9/h2-4,6-8H,5H2,1H3,(H,14,16) |
| InChIKey | ACKSVOOKCHGMHV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |