C20H24N2O3S — CID 75392005
N'-(2-methylsulfinyl-1-phenylethyl)-N-(2,4,6-trimethylphenyl)oxamide (PubChem CID 75392005) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N'-(2-methylsulfinyl-1-phenylethyl)-N-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N'-(2-methylsulfinyl-1-phenylethyl)-N-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 75392005 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N'-(2-methylsulfinyl-1-phenylethyl)-N-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)NC(CS(C)=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-13-10-14(2)18(15(3)11-13)22-20(24)19(23)21-17(12-26(4)25)16-8-6-5-7-9-16/h5-11,17H,12H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | AWZIOVJPMHQXCG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|