C21H36N6O2 — CID 75392019
N-(1-butylpiperidin-4-yl)-N'-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]oxamide (PubChem CID 75392019) has the molecular formula C21H36N6O2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-(1-butylpiperidin-4-yl)-N'-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]oxamide.
| Compound Name | N-(1-butylpiperidin-4-yl)-N'-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 75392019 |
| Molecular Formula | C21H36N6O2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | N-(1-butylpiperidin-4-yl)-N'-[2-(1-ethylpiperidin-4-yl)pyrazol-3-yl]oxamide |
| SMILES | CCCCN1CCC(NC(=O)C(=O)Nc2ccnn2C2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C21H36N6O2/c1-3-5-12-26-13-7-17(8-14-26)23-20(28)21(29)24-19-6-11-22-27(19)18-9-15-25(4-2)16-10-18/h6,11,17-18H,3-5,7-10,12-16H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | IQUDRKIGFYKIAA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|