C17H23F2N3O2 — CID 56806715
N-(1-butylpiperidin-4-yl)-N'-(2,4-difluorophenyl)oxamide (PubChem CID 56806715) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-(1-butylpiperidin-4-yl)-N'-(2,4-difluorophenyl)oxamide.
| Compound Name | N-(1-butylpiperidin-4-yl)-N'-(2,4-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 56806715 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-(1-butylpiperidin-4-yl)-N'-(2,4-difluorophenyl)oxamide |
| SMILES | CCCCN1CCC(NC(=O)C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-2-3-8-22-9-6-13(7-10-22)20-16(23)17(24)21-15-5-4-12(18)11-14(15)19/h4-5,11,13H,2-3,6-10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | SXLXJWUUYFQNDC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|