C19H22F2N4O2 — CID 75392728
2-fluoro-N-[1-[(2-fluoropyridine-4-carbonyl)-methylamino]-4-methylpentan-2-yl]pyridine-4-carboxamide (PubChem CID 75392728) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-fluoro-N-[1-[(2-fluoropyridine-4-carbonyl)-methylamino]-4-methylpentan-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[1-[(2-fluoropyridine-4-carbonyl)-methylamino]-4-methylpentan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 75392728 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-fluoro-N-[1-[(2-fluoropyridine-4-carbonyl)-methylamino]-4-methylpentan-2-yl]pyridine-4-carboxamide |
| SMILES | CC(C)CC(CN(C)C(=O)c1ccnc(F)c1)NC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C19H22F2N4O2/c1-12(2)8-15(24-18(26)13-4-6-22-16(20)9-13)11-25(3)19(27)14-5-7-23-17(21)10-14/h4-7,9-10,12,15H,8,11H2,1-3H3,(H,24,26) |
| InChIKey | FVSBEPYQGQKVDW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|