C17H17N5O — CID 75397330
1-(3,5-dimethylphenyl)-3-(5-pyridin-2-yl-1H-pyrazol-4-yl)urea (PubChem CID 75397330) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(5-pyridin-2-yl-1H-pyrazol-4-yl)urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(5-pyridin-2-yl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 75397330 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(5-pyridin-2-yl-1H-pyrazol-4-yl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2cn[nH]c2-c2ccccn2)c1 |
| InChI | InChI=1S/C17H17N5O/c1-11-7-12(2)9-13(8-11)20-17(23)21-15-10-19-22-16(15)14-5-3-4-6-18-14/h3-10H,1-2H3,(H,19,22)(H2,20,21,23) |
| InChIKey | RBGIMWBGMHFJER-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |