C14H18N6O2 — CID 75399801
1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-(furan-2-ylmethyl)-1-methylurea (PubChem CID 75399801) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-(furan-2-ylmethyl)-1-methylurea.
| Compound Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-(furan-2-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 75399801 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-3-(furan-2-ylmethyl)-1-methylurea |
| SMILES | CN(CCCc1[nH]nc(N)c1C#N)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H18N6O2/c1-20(14(21)17-9-10-4-3-7-22-10)6-2-5-12-11(8-15)13(16)19-18-12/h3-4,7H,2,5-6,9H2,1H3,(H,17,21)(H3,16,18,19) |
| InChIKey | CYPQQIPQHUCJAQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |