C15H18ClN5OS — CID 75403796
1-[(6-chloropyridazin-3-yl)amino]-3-[cyclopentyl(thiophen-2-yl)methyl]urea (PubChem CID 75403796) has the molecular formula C15H18ClN5OS and a molecular weight of 351.86 g/mol. Its IUPAC name is 1-[(6-chloropyridazin-3-yl)amino]-3-[cyclopentyl(thiophen-2-yl)methyl]urea.
| Compound Name | 1-[(6-chloropyridazin-3-yl)amino]-3-[cyclopentyl(thiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 75403796 |
| Molecular Formula | C15H18ClN5OS |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-[(6-chloropyridazin-3-yl)amino]-3-[cyclopentyl(thiophen-2-yl)methyl]urea |
| SMILES | O=C(NNc1ccc(Cl)nn1)NC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C15H18ClN5OS/c16-12-7-8-13(19-18-12)20-21-15(22)17-14(10-4-1-2-5-10)11-6-3-9-23-11/h3,6-10,14H,1-2,4-5H2,(H,19,20)(H2,17,21,22) |
| InChIKey | SOBPXXFXGLCZBD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|